C9H12Cl2N2O3S — CID 114583089
5,6-dichloro-3-(3-ethylsulfonylpropyl)pyrimidin-4-one (PubChem CID 114583089) has the molecular formula C9H12Cl2N2O3S and a molecular weight of 299.18 g/mol. Its IUPAC name is 5,6-dichloro-3-(3-ethylsulfonylpropyl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(3-ethylsulfonylpropyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114583089 |
| Molecular Formula | C9H12Cl2N2O3S |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 5,6-dichloro-3-(3-ethylsulfonylpropyl)pyrimidin-4-one |
| SMILES | CCS(=O)(=O)CCCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C9H12Cl2N2O3S/c1-2-17(15,16)5-3-4-13-6-12-8(11)7(10)9(13)14/h6H,2-5H2,1H3 |
| InChIKey | NNBAFUOHCGWPNK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |