C7H8Cl2N2OS — CID 114583268
5,6-dichloro-3-(2-methylsulfanylethyl)pyrimidin-4-one (PubChem CID 114583268) has the molecular formula C7H8Cl2N2OS and a molecular weight of 239.13 g/mol. Its IUPAC name is 5,6-dichloro-3-(2-methylsulfanylethyl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(2-methylsulfanylethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114583268 |
| Molecular Formula | C7H8Cl2N2OS |
| Molecular Weight | 239.13 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 5,6-dichloro-3-(2-methylsulfanylethyl)pyrimidin-4-one |
| SMILES | CSCCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C7H8Cl2N2OS/c1-13-3-2-11-4-10-6(9)5(8)7(11)12/h4H,2-3H2,1H3 |
| InChIKey | CSSJBRPNXZYOQM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |