C13H16O2 — CID 11458373
(2E,4E)-1-(furan-2-yl)nona-2,4-dien-1-one (PubChem CID 11458373) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2E,4E)-1-(furan-2-yl)nona-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-(furan-2-yl)nona-2,4-dien-1-one |
|---|---|
| PubChem CID | 11458373 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2E,4E)-1-(furan-2-yl)nona-2,4-dien-1-one |
| SMILES | CCCC/C=C/C=C/C(=O)c1ccco1 |
| InChI | InChI=1S/C13H16O2/c1-2-3-4-5-6-7-9-12(14)13-10-8-11-15-13/h5-11H,2-4H2,1H3/b6-5+,9-7+ |
| InChIKey | JCSDHOGNTCRPMM-SBIWHPGTSA-N |
| XLogP | 3.76 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|