C7H5ClF3IN2O — CID 114583765
6-chloro-5-iodo-3-(3,3,3-trifluoropropyl)pyrimidin-4-one (PubChem CID 114583765) has the molecular formula C7H5ClF3IN2O and a molecular weight of 352.48 g/mol. Its IUPAC name is 6-chloro-5-iodo-3-(3,3,3-trifluoropropyl)pyrimidin-4-one.
| Compound Name | 6-chloro-5-iodo-3-(3,3,3-trifluoropropyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114583765 |
| Molecular Formula | C7H5ClF3IN2O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 6-chloro-5-iodo-3-(3,3,3-trifluoropropyl)pyrimidin-4-one |
| SMILES | O=c1c(I)c(Cl)ncn1CCC(F)(F)F |
| InChI | InChI=1S/C7H5ClF3IN2O/c8-5-4(12)6(15)14(3-13-5)2-1-7(9,10)11/h3H,1-2H2 |
| InChIKey | MZNBCBYFMYDPQK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|