C6H4ClF2IN2O — CID 114583931
6-chloro-3-(2,2-difluoroethyl)-5-iodopyrimidin-4-one (PubChem CID 114583931) has the molecular formula C6H4ClF2IN2O and a molecular weight of 320.46 g/mol. Its IUPAC name is 6-chloro-3-(2,2-difluoroethyl)-5-iodopyrimidin-4-one.
| Compound Name | 6-chloro-3-(2,2-difluoroethyl)-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 114583931 |
| Molecular Formula | C6H4ClF2IN2O |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | 6-chloro-3-(2,2-difluoroethyl)-5-iodopyrimidin-4-one |
| SMILES | O=c1c(I)c(Cl)ncn1CC(F)F |
| InChI | InChI=1S/C6H4ClF2IN2O/c7-5-4(10)6(13)12(2-11-5)1-3(8)9/h2-3H,1H2 |
| InChIKey | AIOJACHYOZPCMZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|