C7H7F2IN2O — CID 66341090
3-(2,2-difluoroethyl)-5-iodo-6-methylpyrimidin-4-one (PubChem CID 66341090) has the molecular formula C7H7F2IN2O and a molecular weight of 300.05 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-5-iodo-6-methylpyrimidin-4-one.
| Compound Name | 3-(2,2-difluoroethyl)-5-iodo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 66341090 |
| Molecular Formula | C7H7F2IN2O |
| Molecular Weight | 300.05 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 3-(2,2-difluoroethyl)-5-iodo-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(CC(F)F)c(=O)c1I |
| InChI | InChI=1S/C7H7F2IN2O/c1-4-6(10)7(13)12(3-11-4)2-5(8)9/h3,5H,2H2,1H3 |
| InChIKey | SGBHAUDPVBFUMB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.05 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|