C11H14ClF3N2O2 — CID 114584208
6-chloro-2-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one (PubChem CID 114584208) has the molecular formula C11H14ClF3N2O2 and a molecular weight of 298.69 g/mol. Its IUPAC name is 6-chloro-2-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one.
| Compound Name | 6-chloro-2-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114584208 |
| Molecular Formula | C11H14ClF3N2O2 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 6-chloro-2-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one |
| SMILES | CCc1nc(Cl)cc(=O)n1CCCOCC(F)(F)F |
| InChI | InChI=1S/C11H14ClF3N2O2/c1-2-9-16-8(12)6-10(18)17(9)4-3-5-19-7-11(13,14)15/h6H,2-5,7H2,1H3 |
| InChIKey | JTKSFCKLDGPYME-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|