C9H10ClF3N2O2 — CID 114581981
6-chloro-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one (PubChem CID 114581981) has the molecular formula C9H10ClF3N2O2 and a molecular weight of 270.64 g/mol. Its IUPAC name is 6-chloro-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one.
| Compound Name | 6-chloro-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114581981 |
| Molecular Formula | C9H10ClF3N2O2 |
| Molecular Weight | 270.64 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 6-chloro-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
| SMILES | Cc1nc(Cl)cc(=O)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C9H10ClF3N2O2/c1-6-14-7(10)4-8(16)15(6)2-3-17-5-9(11,12)13/h4H,2-3,5H2,1H3 |
| InChIKey | GXHYWAKNVLMBLY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.64 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|