C11H14O4 — CID 11458480
(1R,4S,5S)-4-methyl-1-[(E)-2-methylpent-2-enoyl]-3,6-dioxabicyclo[3.1.0]hexan-2-one (PubChem CID 11458480) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1R,4S,5S)-4-methyl-1-[(E)-2-methylpent-2-enoyl]-3,6-dioxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,4S,5S)-4-methyl-1-[(E)-2-methylpent-2-enoyl]-3,6-dioxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 11458480 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1R,4S,5S)-4-methyl-1-[(E)-2-methylpent-2-enoyl]-3,6-dioxabicyclo[3.1.0]hexan-2-one |
| SMILES | CC/C=C(\C)C(=O)[C@]12O[C@H]1[C@H](C)OC2=O |
| InChI | InChI=1S/C11H14O4/c1-4-5-6(2)8(12)11-9(15-11)7(3)14-10(11)13/h5,7,9H,4H2,1-3H3/b6-5+/t7-,9-,11-/m0/s1 |
| InChIKey | XTCOHKIKEVZUKZ-NPBRMPGDSA-N |
| XLogP | 0.99 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|