C23H32O4 — CID 123342696
(1R,4S,5S)-1-(10-tert-butyl-2,8-dimethyldodeca-2,6,8,10-tetraenoyl)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one (PubChem CID 123342696) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1R,4S,5S)-1-(10-tert-butyl-2,8-dimethyldodeca-2,6,8,10-tetraenoyl)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,4S,5S)-1-(10-tert-butyl-2,8-dimethyldodeca-2,6,8,10-tetraenoyl)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 123342696 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1R,4S,5S)-1-(10-tert-butyl-2,8-dimethyldodeca-2,6,8,10-tetraenoyl)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one |
| SMILES | CC=C(C=C(C)C=CCCC=C(C)C(=O)[C@]12O[C@H]1[C@H](C)OC2=O)C(C)(C)C |
| InChI | InChI=1S/C23H32O4/c1-8-18(22(5,6)7)14-15(2)12-10-9-11-13-16(3)19(24)23-20(27-23)17(4)26-21(23)25/h8,10,12-14,17,20H,9,11H2,1-7H3/t17-,20-,23-/m0/s1 |
| InChIKey | MWRLZABMPXZKJS-NYDSKATKSA-N |
| XLogP | 4.86 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|