C24H32O6 — CID 90720592
tert-butyl 2-ethylidene-4,10-dimethyl-11-[(1R,4S,5S)-4-methyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]-11-oxoundeca-3,5,8-trienoate (PubChem CID 90720592) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is tert-butyl 2-ethylidene-4,10-dimethyl-11-[(1R,4S,5S)-4-methyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]-11-oxoundeca-3,5,8-trienoate.
| Compound Name | tert-butyl 2-ethylidene-4,10-dimethyl-11-[(1R,4S,5S)-4-methyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]-11-oxoundeca-3,5,8-trienoate |
|---|---|
| PubChem CID | 90720592 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | tert-butyl 2-ethylidene-4,10-dimethyl-11-[(1R,4S,5S)-4-methyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]-11-oxoundeca-3,5,8-trienoate |
| SMILES | CC=C(C=C(C)C=CCC=CC(C)C(=O)[C@]12O[C@H]1[C@H](C)OC2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H32O6/c1-8-18(21(26)30-23(5,6)7)14-15(2)12-10-9-11-13-16(3)19(25)24-20(29-24)17(4)28-22(24)27/h8,10-14,16-17,20H,9H2,1-7H3/t16?,17-,20-,24-/m0/s1 |
| InChIKey | CEWRGRHGNXLFKQ-APBRDWTLSA-N |
| XLogP | 4.01 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|