C16H16O6 — CID 11381150
(1aS,7aS,7bR)-1a-[(2E,4E)-hexa-2,4-dienoyl]-3,7a-dimethyl-7bH-oxireno[2,3-f][1,4]benzodioxine-2,6-dione (PubChem CID 11381150) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is (1aS,7aS,7bR)-1a-[(2E,4E)-hexa-2,4-dienoyl]-3,7a-dimethyl-7bH-oxireno[2,3-f][1,4]benzodioxine-2,6-dione.
| Compound Name | (1aS,7aS,7bR)-1a-[(2E,4E)-hexa-2,4-dienoyl]-3,7a-dimethyl-7bH-oxireno[2,3-f][1,4]benzodioxine-2,6-dione |
|---|---|
| PubChem CID | 11381150 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (1aS,7aS,7bR)-1a-[(2E,4E)-hexa-2,4-dienoyl]-3,7a-dimethyl-7bH-oxireno[2,3-f][1,4]benzodioxine-2,6-dione |
| SMILES | C/C=C/C=C/C(=O)[C@@]12O[C@@H]1[C@]1(C)OC(=O)COC1=C(C)C2=O |
| InChI | InChI=1S/C16H16O6/c1-4-5-6-7-10(17)16-12(19)9(2)13-15(3,14(16)22-16)21-11(18)8-20-13/h4-7,14H,8H2,1-3H3/b5-4+,7-6+/t14-,15-,16+/m1/s1 |
| InChIKey | SVCJGTDJPJWEHR-QRHVBXRGSA-N |
| XLogP | 1.01 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|