C17H16O5 — CID 134977618
(1S,4Z,13R,15R)-5-methyl-16,18-dioxatetracyclo[11.3.2.01,15.07,12]octadeca-4,7(12),9-triene-8,11,17-trione (PubChem CID 134977618) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is (1S,4Z,13R,15R)-5-methyl-16,18-dioxatetracyclo[11.3.2.01,15.07,12]octadeca-4,7(12),9-triene-8,11,17-trione.
| Compound Name | (1S,4Z,13R,15R)-5-methyl-16,18-dioxatetracyclo[11.3.2.01,15.07,12]octadeca-4,7(12),9-triene-8,11,17-trione |
|---|---|
| PubChem CID | 134977618 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (1S,4Z,13R,15R)-5-methyl-16,18-dioxatetracyclo[11.3.2.01,15.07,12]octadeca-4,7(12),9-triene-8,11,17-trione |
| SMILES | C/C1=C/CC[C@]23O[C@@H]2C[C@@H](OC3=O)C2=C(C1)C(=O)C=CC2=O |
| InChI | InChI=1S/C17H16O5/c1-9-3-2-6-17-14(22-17)8-13(21-16(17)20)15-10(7-9)11(18)4-5-12(15)19/h3-5,13-14H,2,6-8H2,1H3/b9-3-/t13-,14-,17+/m1/s1 |
| InChIKey | KPWQTFVOOABBBY-QITMFYESSA-N |
| XLogP | 1.57 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|