C20H28O5 — CID 163067656
(1S,2S,3S,10Z,14R,15R)-2-hydroxy-1,6,10,14-tetramethyl-4,18-dioxatricyclo[13.2.1.03,7]octadeca-6,10-diene-5,8-dione (PubChem CID 163067656) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,2S,3S,10Z,14R,15R)-2-hydroxy-1,6,10,14-tetramethyl-4,18-dioxatricyclo[13.2.1.03,7]octadeca-6,10-diene-5,8-dione.
| Compound Name | (1S,2S,3S,10Z,14R,15R)-2-hydroxy-1,6,10,14-tetramethyl-4,18-dioxatricyclo[13.2.1.03,7]octadeca-6,10-diene-5,8-dione |
|---|---|
| PubChem CID | 163067656 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S,2S,3S,10Z,14R,15R)-2-hydroxy-1,6,10,14-tetramethyl-4,18-dioxatricyclo[13.2.1.03,7]octadeca-6,10-diene-5,8-dione |
| SMILES | CC1=C2C(=O)C/C(C)=C\CC[C@@H](C)[C@H]3CC[C@](C)(O3)[C@@H](O)[C@H]2OC1=O |
| InChI | InChI=1S/C20H28O5/c1-11-6-5-7-12(2)15-8-9-20(4,25-15)18(22)17-16(14(21)10-11)13(3)19(23)24-17/h6,12,15,17-18,22H,5,7-10H2,1-4H3/b11-6-/t12-,15-,17+,18+,20+/m1/s1 |
| InChIKey | RVBQDBFIFUYZKG-KKBGCLGKSA-N |
| XLogP | 2.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|