C16H14O6 — CID 74002729
11-hydroxy-5-methyl-15,17-dioxatetracyclo[11.2.2.01,14.07,12]heptadeca-4,7(12),10-triene-8,9,16-trione (PubChem CID 74002729) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 11-hydroxy-5-methyl-15,17-dioxatetracyclo[11.2.2.01,14.07,12]heptadeca-4,7(12),10-triene-8,9,16-trione.
| Compound Name | 11-hydroxy-5-methyl-15,17-dioxatetracyclo[11.2.2.01,14.07,12]heptadeca-4,7(12),10-triene-8,9,16-trione |
|---|---|
| PubChem CID | 74002729 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 11-hydroxy-5-methyl-15,17-dioxatetracyclo[11.2.2.01,14.07,12]heptadeca-4,7(12),10-triene-8,9,16-trione |
| SMILES | CC1=CCCC23OC2C(OC3=O)C2=C(C1)C(=O)C(=O)C=C2O |
| InChI | InChI=1S/C16H14O6/c1-7-3-2-4-16-14(22-16)13(21-15(16)20)11-8(5-7)12(19)10(18)6-9(11)17/h3,6,13-14,17H,2,4-5H2,1H3 |
| InChIKey | SFYDUWPUVSAYBE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|