C15H16O7 — CID 162868425
(1R,4S,6S,8R,13R,14R)-8-hydroxy-6,11-dimethyl-5,9,15,17-tetraoxapentacyclo[11.2.2.01,14.04,6.08,12]heptadec-11-ene-10,16-dione (PubChem CID 162868425) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is (1R,4S,6S,8R,13R,14R)-8-hydroxy-6,11-dimethyl-5,9,15,17-tetraoxapentacyclo[11.2.2.01,14.04,6.08,12]heptadec-11-ene-10,16-dione.
| Compound Name | (1R,4S,6S,8R,13R,14R)-8-hydroxy-6,11-dimethyl-5,9,15,17-tetraoxapentacyclo[11.2.2.01,14.04,6.08,12]heptadec-11-ene-10,16-dione |
|---|---|
| PubChem CID | 162868425 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (1R,4S,6S,8R,13R,14R)-8-hydroxy-6,11-dimethyl-5,9,15,17-tetraoxapentacyclo[11.2.2.01,14.04,6.08,12]heptadec-11-ene-10,16-dione |
| SMILES | CC1=C2[C@H]3OC(=O)[C@]4(CC[C@@H]5O[C@@]5(C)C[C@@]2(O)OC1=O)O[C@H]34 |
| InChI | InChI=1S/C15H16O7/c1-6-8-9-10-14(21-10,12(17)19-9)4-3-7-13(2,20-7)5-15(8,18)22-11(6)16/h7,9-10,18H,3-5H2,1-2H3/t7-,9+,10+,13-,14+,15+/m0/s1 |
| InChIKey | SZRZCMLKHDXJRR-QSADMQIMSA-N |
| XLogP | -0.05 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|