C16H24O4 — CID 162925443
8-methoxy-3,8,12-trimethyl-4,14-dioxatricyclo[9.3.0.03,5]tetradec-11-en-13-one (PubChem CID 162925443) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 8-methoxy-3,8,12-trimethyl-4,14-dioxatricyclo[9.3.0.03,5]tetradec-11-en-13-one.
| Compound Name | 8-methoxy-3,8,12-trimethyl-4,14-dioxatricyclo[9.3.0.03,5]tetradec-11-en-13-one |
|---|---|
| PubChem CID | 162925443 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 8-methoxy-3,8,12-trimethyl-4,14-dioxatricyclo[9.3.0.03,5]tetradec-11-en-13-one |
| SMILES | COC1(C)CCC2=C(C)C(=O)OC2CC2(C)OC2CC1 |
| InChI | InChI=1S/C16H24O4/c1-10-11-5-7-15(2,18-4)8-6-13-16(3,20-13)9-12(11)19-14(10)17/h12-13H,5-9H2,1-4H3 |
| InChIKey | FULCSTKSEHDKSP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|