C20H30O5 — CID 162895650
(1R,2S,9R,14R,15S)-2,15-dihydroxy-2,6,11,15-tetramethyl-8,18-dioxatricyclo[12.3.1.05,9]octadeca-5,10-dien-7-one (PubChem CID 162895650) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1R,2S,9R,14R,15S)-2,15-dihydroxy-2,6,11,15-tetramethyl-8,18-dioxatricyclo[12.3.1.05,9]octadeca-5,10-dien-7-one.
| Compound Name | (1R,2S,9R,14R,15S)-2,15-dihydroxy-2,6,11,15-tetramethyl-8,18-dioxatricyclo[12.3.1.05,9]octadeca-5,10-dien-7-one |
|---|---|
| PubChem CID | 162895650 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1R,2S,9R,14R,15S)-2,15-dihydroxy-2,6,11,15-tetramethyl-8,18-dioxatricyclo[12.3.1.05,9]octadeca-5,10-dien-7-one |
| SMILES | CC1=C[C@H]2OC(=O)C(C)=C2CC[C@](C)(O)[C@H]2CC[C@](C)(O)[C@@H](CC1)O2 |
| InChI | InChI=1S/C20H30O5/c1-12-5-6-16-20(4,23)10-8-17(25-16)19(3,22)9-7-14-13(2)18(21)24-15(14)11-12/h11,15-17,22-23H,5-10H2,1-4H3/t15-,16-,17-,19+,20+/m1/s1 |
| InChIKey | DJANQNNGVQFNMT-QKMNUUQDSA-N |
| XLogP | 2.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|