C22H31ClO5 — CID 162817607
[(6S,7E,10R,14E,15aR)-11-chloro-10-hydroxy-3,6,10,14-tetramethyl-2-oxo-5,9,11,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-6-yl] acetate (PubChem CID 162817607) has the molecular formula C22H31ClO5 and a molecular weight of 410.94 g/mol. Its IUPAC name is [(6S,7E,10R,14E,15aR)-11-chloro-10-hydroxy-3,6,10,14-tetramethyl-2-oxo-5,9,11,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-6-yl] acetate.
| Compound Name | [(6S,7E,10R,14E,15aR)-11-chloro-10-hydroxy-3,6,10,14-tetramethyl-2-oxo-5,9,11,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-6-yl] acetate |
|---|---|
| PubChem CID | 162817607 |
| Molecular Formula | C22H31ClO5 |
| Molecular Weight | 410.94 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [(6S,7E,10R,14E,15aR)-11-chloro-10-hydroxy-3,6,10,14-tetramethyl-2-oxo-5,9,11,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-6-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)/C=C/C[C@@](C)(O)C(Cl)CC/C(C)=C/[C@H]2OC(=O)C(C)=C2CC1 |
| InChI | InChI=1S/C22H31ClO5/c1-14-7-8-19(23)22(5,26)11-6-10-21(4,28-16(3)24)12-9-17-15(2)20(25)27-18(17)13-14/h6,10,13,18-19,26H,7-9,11-12H2,1-5H3/b10-6+,14-13+/t18-,19?,21-,22-/m1/s1 |
| InChIKey | KGDGALKCDPHUOO-MPHPMYICSA-N |
| XLogP | 4.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|