C20H28O5 — CID 163112868
(4R,6R,9Z,11R,13E,15S)-11-hydroperoxy-4,9,13,18-tetramethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-trien-17-one (PubChem CID 163112868) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (4R,6R,9Z,11R,13E,15S)-11-hydroperoxy-4,9,13,18-tetramethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-trien-17-one.
| Compound Name | (4R,6R,9Z,11R,13E,15S)-11-hydroperoxy-4,9,13,18-tetramethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-trien-17-one |
|---|---|
| PubChem CID | 163112868 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (4R,6R,9Z,11R,13E,15S)-11-hydroperoxy-4,9,13,18-tetramethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-trien-17-one |
| SMILES | CC1=C2CC[C@@]3(C)O[C@@H]3CC/C(C)=C\[C@H](OO)C/C(C)=C/[C@@H]2OC1=O |
| InChI | InChI=1S/C20H28O5/c1-12-5-6-18-20(4,24-18)8-7-16-14(3)19(21)23-17(16)11-13(2)10-15(9-12)25-22/h9,11,15,17-18,22H,5-8,10H2,1-4H3/b12-9-,13-11+/t15-,17-,18+,20+/m0/s1 |
| InChIKey | QZJBESRVGILFBE-ICDFMABQSA-N |
| XLogP | 4.10 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|