C20H28O4 — CID 73293938
(1S,9S,10E,14S,15R)-14-hydroxy-6,11,15-trimethyl-2-methylidene-8,18-dioxatricyclo[13.2.1.05,9]octadeca-5,10-dien-7-one (PubChem CID 73293938) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,9S,10E,14S,15R)-14-hydroxy-6,11,15-trimethyl-2-methylidene-8,18-dioxatricyclo[13.2.1.05,9]octadeca-5,10-dien-7-one.
| Compound Name | (1S,9S,10E,14S,15R)-14-hydroxy-6,11,15-trimethyl-2-methylidene-8,18-dioxatricyclo[13.2.1.05,9]octadeca-5,10-dien-7-one |
|---|---|
| PubChem CID | 73293938 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,9S,10E,14S,15R)-14-hydroxy-6,11,15-trimethyl-2-methylidene-8,18-dioxatricyclo[13.2.1.05,9]octadeca-5,10-dien-7-one |
| SMILES | C=C1CCC2=C(C)C(=O)O[C@H]2/C=C(\C)CC[C@H](O)[C@@]2(C)CC[C@@H]1O2 |
| InChI | InChI=1S/C20H28O4/c1-12-5-8-18(21)20(4)10-9-16(24-20)13(2)6-7-15-14(3)19(22)23-17(15)11-12/h11,16-18,21H,2,5-10H2,1,3-4H3/b12-11+/t16-,17-,18-,20+/m0/s1 |
| InChIKey | ZWUIONUUKVUPHT-SEDHWTCBSA-N |
| XLogP | 3.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|