C25H37NO4 — CID 53484166
[(6E,11S,14E,15aS)-3,6,14-trimethyl-10-methylidene-2-oxo-4,5,8,9,11,12,13,15a-octahydrocyclotetradeca[b]furan-11-yl] N-butylcarbamate (PubChem CID 53484166) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is [(6E,11S,14E,15aS)-3,6,14-trimethyl-10-methylidene-2-oxo-4,5,8,9,11,12,13,15a-octahydrocyclotetradeca[b]furan-11-yl] N-butylcarbamate.
| Compound Name | [(6E,11S,14E,15aS)-3,6,14-trimethyl-10-methylidene-2-oxo-4,5,8,9,11,12,13,15a-octahydrocyclotetradeca[b]furan-11-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 53484166 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | [(6E,11S,14E,15aS)-3,6,14-trimethyl-10-methylidene-2-oxo-4,5,8,9,11,12,13,15a-octahydrocyclotetradeca[b]furan-11-yl] N-butylcarbamate |
| SMILES | C=C1CC/C=C(\C)CCC2=C(C)C(=O)O[C@H]2/C=C(\C)CC[C@@H]1OC(=O)NCCCC |
| InChI | InChI=1S/C25H37NO4/c1-6-7-15-26-25(28)30-22-14-12-18(3)16-23-21(20(5)24(27)29-23)13-11-17(2)9-8-10-19(22)4/h9,16,22-23H,4,6-8,10-15H2,1-3,5H3,(H,26,28)/b17-9+,18-16+/t22-,23-/m0/s1 |
| InChIKey | NFTZGUMCDSVLSN-MZBRAGMFSA-N |
| XLogP | 5.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|