C22H32O4 — CID 163113196
(4,9,13,18-tetramethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-trien-11-yl) acetate (PubChem CID 163113196) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (4,9,13,18-tetramethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-trien-11-yl) acetate.
| Compound Name | (4,9,13,18-tetramethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-trien-11-yl) acetate |
|---|---|
| PubChem CID | 163113196 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (4,9,13,18-tetramethyl-5,16-dioxatricyclo[13.3.0.04,6]octadeca-1(18),9,13-trien-11-yl) acetate |
| SMILES | CC(=O)OC1C=C(C)CCC2OC2(C)CCC2=C(C)COC2C=C(C)C1 |
| InChI | InChI=1S/C22H32O4/c1-14-6-7-21-22(5,26-21)9-8-19-16(3)13-24-20(19)12-15(2)11-18(10-14)25-17(4)23/h10,12,18,20-21H,6-9,11,13H2,1-5H3 |
| InChIKey | RROSMSZEMATWOG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|