C15H20O5 — CID 163014345
(1R,2R,9R,10S)-9-hydroxy-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.02,6]tetradec-5-ene-4,13-dione (PubChem CID 163014345) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1R,2R,9R,10S)-9-hydroxy-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.02,6]tetradec-5-ene-4,13-dione.
| Compound Name | (1R,2R,9R,10S)-9-hydroxy-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.02,6]tetradec-5-ene-4,13-dione |
|---|---|
| PubChem CID | 163014345 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1R,2R,9R,10S)-9-hydroxy-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.02,6]tetradec-5-ene-4,13-dione |
| SMILES | CC1=C2CC[C@@](C)(O)[C@@H]3CCC(=O)O[C@@]3(C)[C@@H]2OC1=O |
| InChI | InChI=1S/C15H20O5/c1-8-9-6-7-14(2,18)10-4-5-11(16)20-15(10,3)12(9)19-13(8)17/h10,12,18H,4-7H2,1-3H3/t10-,12+,14+,15+/m0/s1 |
| InChIKey | RDLLMKZWCBKKMZ-QMGNLALYSA-N |
| XLogP | 1.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |