C15H22O4 — CID 162846363
6-hydroxy-3,6,9a-trimethyl-3,3a,4,5,6a,7,8,9b-octahydroazuleno[8,7-b]furan-2,9-dione (PubChem CID 162846363) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 6-hydroxy-3,6,9a-trimethyl-3,3a,4,5,6a,7,8,9b-octahydroazuleno[8,7-b]furan-2,9-dione.
| Compound Name | 6-hydroxy-3,6,9a-trimethyl-3,3a,4,5,6a,7,8,9b-octahydroazuleno[8,7-b]furan-2,9-dione |
|---|---|
| PubChem CID | 162846363 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 6-hydroxy-3,6,9a-trimethyl-3,3a,4,5,6a,7,8,9b-octahydroazuleno[8,7-b]furan-2,9-dione |
| SMILES | CC1C(=O)OC2C1CCC(C)(O)C1CCC(=O)C21C |
| InChI | InChI=1S/C15H22O4/c1-8-9-6-7-14(2,18)10-4-5-11(16)15(10,3)12(9)19-13(8)17/h8-10,12,18H,4-7H2,1-3H3 |
| InChIKey | IUUCPMXTYQHRQG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |