C15H18O4 — CID 162867595
6a-hydroxy-3,6,9a-trimethyl-4,5,6,9b-tetrahydroazuleno[8,7-b]furan-2,9-dione (PubChem CID 162867595) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 6a-hydroxy-3,6,9a-trimethyl-4,5,6,9b-tetrahydroazuleno[8,7-b]furan-2,9-dione.
| Compound Name | 6a-hydroxy-3,6,9a-trimethyl-4,5,6,9b-tetrahydroazuleno[8,7-b]furan-2,9-dione |
|---|---|
| PubChem CID | 162867595 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 6a-hydroxy-3,6,9a-trimethyl-4,5,6,9b-tetrahydroazuleno[8,7-b]furan-2,9-dione |
| SMILES | CC1=C2CCC(C)C3(O)C=CC(=O)C3(C)C2OC1=O |
| InChI | InChI=1S/C15H18O4/c1-8-4-5-10-9(2)13(17)19-12(10)14(3)11(16)6-7-15(8,14)18/h6-8,12,18H,4-5H2,1-3H3 |
| InChIKey | BPVQNBYPLJDFIA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |