C23H25NO6 — CID 53375896
(3aR,6S,6aS,9aS,9bR)-6a-hydroxy-3'-(4-methoxyphenyl)-6,9a-dimethylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione (PubChem CID 53375896) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-3'-(4-methoxyphenyl)-6,9a-dimethylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione.
| Compound Name | (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-3'-(4-methoxyphenyl)-6,9a-dimethylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione |
|---|---|
| PubChem CID | 53375896 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-3'-(4-methoxyphenyl)-6,9a-dimethylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione |
| SMILES | COc1ccc(C2=NOC3(C2)C(=O)O[C@@H]2[C@H]3CC[C@H](C)[C@]3(O)C=CC(=O)[C@@]23C)cc1 |
| InChI | InChI=1S/C23H25NO6/c1-13-4-9-16-19(21(2)18(25)10-11-23(13,21)27)29-20(26)22(16)12-17(24-30-22)14-5-7-15(28-3)8-6-14/h5-8,10-11,13,16,19,27H,4,9,12H2,1-3H3/t13-,16+,19+,21-,22?,23+/m0/s1 |
| InChIKey | HGDFINKILRNTAQ-RWLFSVEVSA-N |
| XLogP | 2.41 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |