C22H25NO4 — CID 53376437
(3aS,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-1'-(2-methylphenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,2'-aziridine]-2,9-dione (PubChem CID 53376437) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3aS,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-1'-(2-methylphenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,2'-aziridine]-2,9-dione.
| Compound Name | (3aS,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-1'-(2-methylphenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,2'-aziridine]-2,9-dione |
|---|---|
| PubChem CID | 53376437 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3aS,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-1'-(2-methylphenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,2'-aziridine]-2,9-dione |
| SMILES | Cc1ccccc1N1CC12C(=O)O[C@@H]1[C@H]2CC[C@H](C)[C@]2(O)C=CC(=O)[C@@]12C |
| InChI | InChI=1S/C22H25NO4/c1-13-6-4-5-7-16(13)23-12-21(23)15-9-8-14(2)22(26)11-10-17(24)20(22,3)18(15)27-19(21)25/h4-7,10-11,14-15,18,26H,8-9,12H2,1-3H3/t14-,15+,18+,20-,21?,22+,23?/m0/s1 |
| InChIKey | WQPGRCRMOMNWDD-YELDRKHXSA-N |
| XLogP | 2.40 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|