C19H28O6 — CID 162843473
(8a,9a-dihydroxy-3,4a,5-trimethyl-2-oxo-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl) 2-methylpropanoate (PubChem CID 162843473) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is (8a,9a-dihydroxy-3,4a,5-trimethyl-2-oxo-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl) 2-methylpropanoate.
| Compound Name | (8a,9a-dihydroxy-3,4a,5-trimethyl-2-oxo-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 162843473 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (8a,9a-dihydroxy-3,4a,5-trimethyl-2-oxo-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl) 2-methylpropanoate |
| SMILES | CC1=C2C(OC(=O)C(C)C)C3(C)C(C)CCCC3(O)CC2(O)OC1=O |
| InChI | InChI=1S/C19H28O6/c1-10(2)15(20)24-14-13-12(4)16(21)25-19(13,23)9-18(22)8-6-7-11(3)17(14,18)5/h10-11,14,22-23H,6-9H2,1-5H3 |
| InChIKey | SWBUICHZUKBNOP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |