C19H24O6 — CID 101456858
[(4R,4aR,5R,8aS)-8a-hydroxy-3,4a,5-trimethyl-2,8-dioxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-4-yl] 2-methylpropanoate (PubChem CID 101456858) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(4R,4aR,5R,8aS)-8a-hydroxy-3,4a,5-trimethyl-2,8-dioxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-4-yl] 2-methylpropanoate.
| Compound Name | [(4R,4aR,5R,8aS)-8a-hydroxy-3,4a,5-trimethyl-2,8-dioxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-4-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 101456858 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(4R,4aR,5R,8aS)-8a-hydroxy-3,4a,5-trimethyl-2,8-dioxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-4-yl] 2-methylpropanoate |
| SMILES | CC1=C2C(=C[C@@]3(O)C(=O)CC[C@@H](C)[C@]3(C)[C@H]2OC(=O)C(C)C)OC1=O |
| InChI | InChI=1S/C19H24O6/c1-9(2)16(21)25-15-14-11(4)17(22)24-12(14)8-19(23)13(20)7-6-10(3)18(15,19)5/h8-10,15,23H,6-7H2,1-5H3/t10-,15+,18-,19-/m1/s1 |
| InChIKey | GUIUSCZLHIXZMW-WUARICJSSA-N |
| XLogP | 2.06 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |