C21H28O6 — CID 162998475
(3-ethoxy-6,9,10-trimethyl-5-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradec-6-en-8-yl) 2-methylprop-2-enoate (PubChem CID 162998475) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (3-ethoxy-6,9,10-trimethyl-5-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradec-6-en-8-yl) 2-methylprop-2-enoate.
| Compound Name | (3-ethoxy-6,9,10-trimethyl-5-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradec-6-en-8-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162998475 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3-ethoxy-6,9,10-trimethyl-5-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradec-6-en-8-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2=C(C)C(=O)OC2(OCC)CC23OC2CCC(C)C13C |
| InChI | InChI=1S/C21H28O6/c1-7-24-21-10-20-14(26-20)9-8-12(4)19(20,6)16(25-17(22)11(2)3)15(21)13(5)18(23)27-21/h12,14,16H,2,7-10H2,1,3-6H3 |
| InChIKey | UEYXHFVQQGVQGL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|