C21H28O6 — CID 11143307
methyl (2E,3E,5E,9E)-2-ethylidene-11-hydroxy-4,10-dimethyl-11-[(1S,4S,5S)-4-methyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]undeca-3,5,9-trienoate (PubChem CID 11143307) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is methyl (2E,3E,5E,9E)-2-ethylidene-11-hydroxy-4,10-dimethyl-11-[(1S,4S,5S)-4-methyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]undeca-3,5,9-trienoate.
| Compound Name | methyl (2E,3E,5E,9E)-2-ethylidene-11-hydroxy-4,10-dimethyl-11-[(1S,4S,5S)-4-methyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]undeca-3,5,9-trienoate |
|---|---|
| PubChem CID | 11143307 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | methyl (2E,3E,5E,9E)-2-ethylidene-11-hydroxy-4,10-dimethyl-11-[(1S,4S,5S)-4-methyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]undeca-3,5,9-trienoate |
| SMILES | C/C=C(\C=C(C)\C=C\CC/C=C(\C)C(O)[C@]12O[C@H]1[C@H](C)OC2=O)C(=O)OC |
| InChI | InChI=1S/C21H28O6/c1-6-16(19(23)25-5)12-13(2)10-8-7-9-11-14(3)17(22)21-18(27-21)15(4)26-20(21)24/h6,8,10-12,15,17-18,22H,7,9H2,1-5H3/b10-8+,13-12+,14-11+,16-6+/t15-,17?,18-,21-/m0/s1 |
| InChIKey | CKGAJQLVURFFNA-NPADWIGGSA-N |
| XLogP | 2.78 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|