C7H10ClN3O2 — CID 114586296
5-chloro-4-[2-(methylamino)ethoxy]-1H-pyrimidin-6-one (PubChem CID 114586296) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 5-chloro-4-[2-(methylamino)ethoxy]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-(methylamino)ethoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114586296 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 5-chloro-4-[2-(methylamino)ethoxy]-1H-pyrimidin-6-one |
| SMILES | CNCCOc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C7H10ClN3O2/c1-9-2-3-13-7-5(8)6(12)10-4-11-7/h4,9H,2-3H2,1H3,(H,10,11,12) |
| InChIKey | ZWCRHUVPMJRGTG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|