C7H11N3O3 — CID 114586358
4-(2-aminoethoxy)-5-methoxy-1H-pyrimidin-6-one (PubChem CID 114586358) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-(2-aminoethoxy)-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114586358 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-(2-aminoethoxy)-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(OCCN)nc[nH]c1=O |
| InChI | InChI=1S/C7H11N3O3/c1-12-5-6(11)9-4-10-7(5)13-3-2-8/h4H,2-3,8H2,1H3,(H,9,10,11) |
| InChIKey | WVOMGFCBLIVMFU-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |