C7H9F2N3O2 — CID 136976581
4-(2,2-difluoroethylamino)-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136976581) has the molecular formula C7H9F2N3O2 and a molecular weight of 205.16 g/mol. Its IUPAC name is 4-(2,2-difluoroethylamino)-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2-difluoroethylamino)-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976581 |
| Molecular Formula | C7H9F2N3O2 |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-(2,2-difluoroethylamino)-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(NCC(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C7H9F2N3O2/c1-14-5-6(10-2-4(8)9)11-3-12-7(5)13/h3-4H,2H2,1H3,(H2,10,11,12,13) |
| InChIKey | CJDNFDACPZETCB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |