C8H7F5N2O3 — CID 103241789
5-methoxy-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 103241789) has the molecular formula C8H7F5N2O3 and a molecular weight of 274.14 g/mol. Its IUPAC name is 5-methoxy-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241789 |
| Molecular Formula | C8H7F5N2O3 |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 5-methoxy-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | COc1c(OCC(F)(F)C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C8H7F5N2O3/c1-17-4-5(16)14-3-15-6(4)18-2-7(9,10)8(11,12)13/h3H,2H2,1H3,(H,14,15,16) |
| InChIKey | FWGBODLCDISAME-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|