C6H6F2N2O2 — CID 178112084
5-(2,2-difluoroethoxy)-1H-pyrimidin-6-one (PubChem CID 178112084) has the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-(2,2-difluoroethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 178112084 |
| Molecular Formula | C6H6F2N2O2 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cncc1OCC(F)F |
| InChI | InChI=1S/C6H6F2N2O2/c7-5(8)2-12-4-1-9-3-10-6(4)11/h1,3,5H,2H2,(H,9,10,11) |
| InChIKey | BDHSJFPJYJRORJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |