C7H7F3N2O3 — CID 103240548
5-methoxy-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one (PubChem CID 103240548) has the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. Its IUPAC name is 5-methoxy-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240548 |
| Molecular Formula | C7H7F3N2O3 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-methoxy-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
| SMILES | COc1c(OCC(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C7H7F3N2O3/c1-14-4-5(13)11-3-12-6(4)15-2-7(8,9)10/h3H,2H2,1H3,(H,11,12,13) |
| InChIKey | OWBFWLJAROXXQK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |