C8H12BrN3O2 — CID 114586331
5-bromo-4-[2-(ethylamino)ethoxy]-1H-pyrimidin-6-one (PubChem CID 114586331) has the molecular formula C8H12BrN3O2 and a molecular weight of 262.11 g/mol. Its IUPAC name is 5-bromo-4-[2-(ethylamino)ethoxy]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[2-(ethylamino)ethoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114586331 |
| Molecular Formula | C8H12BrN3O2 |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 5-bromo-4-[2-(ethylamino)ethoxy]-1H-pyrimidin-6-one |
| SMILES | CCNCCOc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C8H12BrN3O2/c1-2-10-3-4-14-8-6(9)7(13)11-5-12-8/h5,10H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | UGKITDVLERGDSJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|