C9H15N3O3 — CID 114586330
4-[2-(ethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 114586330) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-[2-(ethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(ethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114586330 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 4-[2-(ethylamino)ethoxy]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | CCNCCOc1nc[nH]c(=O)c1OC |
| InChI | InChI=1S/C9H15N3O3/c1-3-10-4-5-15-9-7(14-2)8(13)11-6-12-9/h6,10H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | ODQKDQBDQIBDQV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|