C12H19N3O2 — CID 114586495
4-[(1-aminocycloheptyl)methoxy]-1H-pyrimidin-6-one (PubChem CID 114586495) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-[(1-aminocycloheptyl)methoxy]-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-aminocycloheptyl)methoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114586495 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-[(1-aminocycloheptyl)methoxy]-1H-pyrimidin-6-one |
| SMILES | NC1(COc2cc(=O)[nH]cn2)CCCCCC1 |
| InChI | InChI=1S/C12H19N3O2/c13-12(5-3-1-2-4-6-12)8-17-11-7-10(16)14-9-15-11/h7,9H,1-6,8,13H2,(H,14,15,16) |
| InChIKey | NBQYHOLZQWKXQT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |