C10H9BrN2OS — CID 114588976
7-bromo-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 114588976) has the molecular formula C10H9BrN2OS and a molecular weight of 285.17 g/mol. Its IUPAC name is 7-bromo-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-bromo-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 114588976 |
| Molecular Formula | C10H9BrN2OS |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 7-bromo-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCn1c(=S)[nH]c2cc(Br)ccc2c1=O |
| InChI | InChI=1S/C10H9BrN2OS/c1-2-13-9(14)7-4-3-6(11)5-8(7)12-10(13)15/h3-5H,2H2,1H3,(H,12,15) |
| InChIKey | KGDQHOGZMIZOSZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|