C10H8Br2N2OS — CID 115571521
6,8-dibromo-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 115571521) has the molecular formula C10H8Br2N2OS and a molecular weight of 364.06 g/mol. Its IUPAC name is 6,8-dibromo-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 6,8-dibromo-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 115571521 |
| Molecular Formula | C10H8Br2N2OS |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 361.87 |
| IUPAC Name | 6,8-dibromo-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCn1c(=S)[nH]c2c(Br)cc(Br)cc2c1=O |
| InChI | InChI=1S/C10H8Br2N2OS/c1-2-14-9(15)6-3-5(11)4-7(12)8(6)13-10(14)16/h3-4H,2H2,1H3,(H,13,16) |
| InChIKey | QQVIEZKEDJYFAF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|