C17H14Cl2N2 — CID 114589548
4,7-dichloro-2-(4-ethylphenyl)-8-methylquinazoline (PubChem CID 114589548) has the molecular formula C17H14Cl2N2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 4,7-dichloro-2-(4-ethylphenyl)-8-methylquinazoline.
| Compound Name | 4,7-dichloro-2-(4-ethylphenyl)-8-methylquinazoline |
|---|---|
| PubChem CID | 114589548 |
| Molecular Formula | C17H14Cl2N2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4,7-dichloro-2-(4-ethylphenyl)-8-methylquinazoline |
| SMILES | CCc1ccc(-c2nc(Cl)c3ccc(Cl)c(C)c3n2)cc1 |
| InChI | InChI=1S/C17H14Cl2N2/c1-3-11-4-6-12(7-5-11)17-20-15-10(2)14(18)9-8-13(15)16(19)21-17/h4-9H,3H2,1-2H3 |
| InChIKey | BAEXCYDBPQOCAF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |