C16H12Cl2N2S — CID 114589554
4,7-dichloro-8-methyl-2-(4-methylsulfanylphenyl)quinazoline (PubChem CID 114589554) has the molecular formula C16H12Cl2N2S and a molecular weight of 335.26 g/mol. Its IUPAC name is 4,7-dichloro-8-methyl-2-(4-methylsulfanylphenyl)quinazoline.
| Compound Name | 4,7-dichloro-8-methyl-2-(4-methylsulfanylphenyl)quinazoline |
|---|---|
| PubChem CID | 114589554 |
| Molecular Formula | C16H12Cl2N2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 4,7-dichloro-8-methyl-2-(4-methylsulfanylphenyl)quinazoline |
| SMILES | CSc1ccc(-c2nc(Cl)c3ccc(Cl)c(C)c3n2)cc1 |
| InChI | InChI=1S/C16H12Cl2N2S/c1-9-13(17)8-7-12-14(9)19-16(20-15(12)18)10-3-5-11(21-2)6-4-10/h3-8H,1-2H3 |
| InChIKey | JKZDTDCKOOWWIB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |