About 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline
2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline (PubChem CID 114590319) has the molecular formula C14H6BrCl3N2
and a molecular weight of 388.48 g/mol. Its IUPAC name is 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline.
Molecular Properties
| Compound Name | 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline |
| PubChem CID | 114590319 |
| Molecular Formula | C14H6BrCl3N2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 385.88 |
| IUPAC Name | 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline |
| SMILES | Clc1ccc(Br)cc1-c1nc(Cl)c2c(Cl)cccc2n1 |
| InChI | InChI=1S/C14H6BrCl3N2/c15-7-4-5-9(16)8(6-7)14-19-11-3-1-2-10(17)12(11)13(18)20-14/h1-6H |
| InChIKey | YZWYQCQLQIEFSC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline?
The IUPAC name of 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline (CID 114590319) is 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline.
What is the SMILES notation for 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline?
The canonical SMILES for 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline is Clc1ccc(Br)cc1-c1nc(Cl)c2c(Cl)cccc2n1.
What is the InChIKey of 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline?
The InChIKey is YZWYQCQLQIEFSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6BrCl3N2/c15-7-4-5-9(16)8(6-7)14-19-11-3-1-2-10(17)12(11)13(18)20-14/h1-6H.
What are the key properties of 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline?
2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline has a molecular weight of 388.48 g/mol, XLogP of 6.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-2-chlorophenyl)-4,5-dichloroquinazoline is sourced from PubChem (CID 114590319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).