C16H10Cl2N2O — CID 114590291
4,5-dichloro-2-(1,3-dihydro-2-benzofuran-5-yl)quinazoline (PubChem CID 114590291) has the molecular formula C16H10Cl2N2O and a molecular weight of 317.18 g/mol. Its IUPAC name is 4,5-dichloro-2-(1,3-dihydro-2-benzofuran-5-yl)quinazoline.
| Compound Name | 4,5-dichloro-2-(1,3-dihydro-2-benzofuran-5-yl)quinazoline |
|---|---|
| PubChem CID | 114590291 |
| Molecular Formula | C16H10Cl2N2O |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 4,5-dichloro-2-(1,3-dihydro-2-benzofuran-5-yl)quinazoline |
| SMILES | Clc1cccc2nc(-c3ccc4c(c3)COC4)nc(Cl)c12 |
| InChI | InChI=1S/C16H10Cl2N2O/c17-12-2-1-3-13-14(12)15(18)20-16(19-13)9-4-5-10-7-21-8-11(10)6-9/h1-6H,7-8H2 |
| InChIKey | XESBOVYFMVTLBW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |