C17H26N4 — CID 114592217
2-[2-(2,3,5-trimethylpiperidin-1-yl)ethyl]-3H-benzimidazol-5-amine (PubChem CID 114592217) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-[2-(2,3,5-trimethylpiperidin-1-yl)ethyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[2-(2,3,5-trimethylpiperidin-1-yl)ethyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 114592217 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 2-[2-(2,3,5-trimethylpiperidin-1-yl)ethyl]-3H-benzimidazol-5-amine |
| SMILES | CC1CC(C)C(C)N(CCc2nc3ccc(N)cc3[nH]2)C1 |
| InChI | InChI=1S/C17H26N4/c1-11-8-12(2)13(3)21(10-11)7-6-17-19-15-5-4-14(18)9-16(15)20-17/h4-5,9,11-13H,6-8,10,18H2,1-3H3,(H,19,20) |
| InChIKey | PQHQVXHJAPADGW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|