About 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid
2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid (PubChem CID 114594006) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid.
Analyze 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid?
The IUPAC name of 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid (CID 114594006) is 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid is CC1CC(C)C(C)N(C2CCC2C(=O)O)C1.
What is the InChIKey of 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid?
The InChIKey is AAUWNPZNBXBHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-8-6-9(2)10(3)14(7-8)12-5-4-11(12)13(15)16/h8-12H,4-7H2,1-3H3,(H,15,16).
What are the key properties of 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid?
2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid has a molecular weight of 225.33 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,5-trimethylpiperidin-1-yl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 114594006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).