2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid

C11H19NO3 — CID 80997136

IUPAC2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid
SMILESCC1CN(C2CCC2C(=O)O)C(C)CO1
InChIInChI=1S/C11H19NO3/c1-7-6-15-8(2)5-12(7)10-4-3-9(10)11(13)14/h7-10H,3-6H2,1-2H3,(H,13,14)
InChIKeyVRLQRNPIOZTNGW-UHFFFAOYSA-N
MW213.28 g/mol
LogP0.96
Rot. Bonds2

About 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid

2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid (PubChem CID 80997136) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid
PubChem CID80997136
Molecular FormulaC11H19NO3
Molecular Weight213.28 g/mol
Exact Mass213.14
IUPAC Name2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid
SMILESCC1CN(C2CCC2C(=O)O)C(C)CO1
InChIInChI=1S/C11H19NO3/c1-7-6-15-8(2)5-12(7)10-4-3-9(10)11(13)14/h7-10H,3-6H2,1-2H3,(H,13,14)
InChIKeyVRLQRNPIOZTNGW-UHFFFAOYSA-N
XLogP0.96
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.28
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid?
The IUPAC name of 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid (CID 80997136) is 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid is CC1CN(C2CCC2C(=O)O)C(C)CO1.
What is the InChIKey of 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid?
The InChIKey is VRLQRNPIOZTNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-7-6-15-8(2)5-12(7)10-4-3-9(10)11(13)14/h7-10H,3-6H2,1-2H3,(H,13,14).
What are the key properties of 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid?
2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid has a molecular weight of 213.28 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylmorpholin-4-yl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 80997136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).